Регистрация компании на PromPortal.su

1-Фенил-2-нитропропен (F2NP, Фенилнитропропен)

Описание
1-Фенил-2-нитропропен, F2NP, Фенилнитропропен

Содержание основного вещества 99%

Квалификация: " Для Синтеза"

Производитель: "Реактив"

Описание:
Название продукта 2-Nitro-1-phenylpropene. 2-Нитро-1-Фенилпропилен

Синонимы 1-Phenyl-2-nitropropene.1-Фенил-2-нитропропен.фенилнитропропен. П2НП.P2NP

Молекулярная формула C9H9NO2

Молекулярный вес 163.1733 InChI InChI1C9H9NO2c1-8(10(11)12)7-9-5-3-2-4-6-9h2-7H,1H3b8-7

Регистрационный номер CAS 705-60-2

Молекулярная структура Плотность 1.141gcm3

Температура плавления 64-67



Название продукта 2-Nitro-1-phenylpropene. 2-Нитро-1-Фенилпропилен
Молекулярная формула C9H9NO2

http://reaktiv-rf.promportal.su

http://reaktiv-rf.ru

Адрес: Г САНКТ-ПЕТЕРБУРГ

E-mail:
info@reaktiv-rf.ru
reaktiv-rf@ya.ru
offis.reaktiv@gmail.com

Skype: Reaktiv-RF1